About ethenyl-silyloxy-(3,3,3-trifluoropropyl)silane
ethenyl-silyloxy-(3,3,3-trifluoropropyl)silane (PubChem CID 123694326) has the molecular formula C5H11F3OSi2
and a molecular weight of 200.31 g/mol. Its IUPAC name is ethenyl-silyloxy-(3,3,3-trifluoropropyl)silane.
Molecular Properties
| Compound Name | ethenyl-silyloxy-(3,3,3-trifluoropropyl)silane |
| PubChem CID | 123694326 |
| Molecular Formula | C5H11F3OSi2 |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | ethenyl-silyloxy-(3,3,3-trifluoropropyl)silane |
| SMILES | C=C[SiH](CCC(F)(F)F)O[SiH3] |
| InChI | InChI=1S/C5H11F3OSi2/c1-2-11(9-10)4-3-5(6,7)8/h2,11H,1,3-4H2,10H3 |
| InChIKey | QTUHXUMLLIVACY-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethenyl-silyloxy-(3,3,3-trifluoropropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl-silyloxy-(3,3,3-trifluoropropyl)silane?
The IUPAC name of ethenyl-silyloxy-(3,3,3-trifluoropropyl)silane (CID 123694326) is ethenyl-silyloxy-(3,3,3-trifluoropropyl)silane.
What is the SMILES notation for ethenyl-silyloxy-(3,3,3-trifluoropropyl)silane?
The canonical SMILES for ethenyl-silyloxy-(3,3,3-trifluoropropyl)silane is C=C[SiH](CCC(F)(F)F)O[SiH3].
What is the InChIKey of ethenyl-silyloxy-(3,3,3-trifluoropropyl)silane?
The InChIKey is QTUHXUMLLIVACY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11F3OSi2/c1-2-11(9-10)4-3-5(6,7)8/h2,11H,1,3-4H2,10H3.
What are the key properties of ethenyl-silyloxy-(3,3,3-trifluoropropyl)silane?
ethenyl-silyloxy-(3,3,3-trifluoropropyl)silane has a molecular weight of 200.31 g/mol, XLogP of 0.68, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl-silyloxy-(3,3,3-trifluoropropyl)silane is sourced from PubChem (CID 123694326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).