About (3-tert-butyl-5,5-dimethylhex-2-enyl)-dimethyl-trimethylsilyloxysilane
(3-tert-butyl-5,5-dimethylhex-2-enyl)-dimethyl-trimethylsilyloxysilane (PubChem CID 123694506) has the molecular formula C17H38OSi2
and a molecular weight of 314.66 g/mol. Its IUPAC name is (3-tert-butyl-5,5-dimethylhex-2-enyl)-dimethyl-trimethylsilyloxysilane.
Molecular Properties
| Compound Name | (3-tert-butyl-5,5-dimethylhex-2-enyl)-dimethyl-trimethylsilyloxysilane |
| PubChem CID | 123694506 |
| Molecular Formula | C17H38OSi2 |
| Molecular Weight | 314.66 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | (3-tert-butyl-5,5-dimethylhex-2-enyl)-dimethyl-trimethylsilyloxysilane |
| SMILES | CC(C)(C)CC(=CC[Si](C)(C)O[Si](C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C17H38OSi2/c1-16(2,3)14-15(17(4,5)6)12-13-20(10,11)18-19(7,8)9/h12H,13-14H2,1-11H3 |
| InChIKey | CYZMLUXMJHHCNP-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.66 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3-tert-butyl-5,5-dimethylhex-2-enyl)-dimethyl-trimethylsilyloxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-tert-butyl-5,5-dimethylhex-2-enyl)-dimethyl-trimethylsilyloxysilane?
The IUPAC name of (3-tert-butyl-5,5-dimethylhex-2-enyl)-dimethyl-trimethylsilyloxysilane (CID 123694506) is (3-tert-butyl-5,5-dimethylhex-2-enyl)-dimethyl-trimethylsilyloxysilane.
What is the SMILES notation for (3-tert-butyl-5,5-dimethylhex-2-enyl)-dimethyl-trimethylsilyloxysilane?
The canonical SMILES for (3-tert-butyl-5,5-dimethylhex-2-enyl)-dimethyl-trimethylsilyloxysilane is CC(C)(C)CC(=CC[Si](C)(C)O[Si](C)(C)C)C(C)(C)C.
What is the InChIKey of (3-tert-butyl-5,5-dimethylhex-2-enyl)-dimethyl-trimethylsilyloxysilane?
The InChIKey is CYZMLUXMJHHCNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H38OSi2/c1-16(2,3)14-15(17(4,5)6)12-13-20(10,11)18-19(7,8)9/h12H,13-14H2,1-11H3.
What are the key properties of (3-tert-butyl-5,5-dimethylhex-2-enyl)-dimethyl-trimethylsilyloxysilane?
(3-tert-butyl-5,5-dimethylhex-2-enyl)-dimethyl-trimethylsilyloxysilane has a molecular weight of 314.66 g/mol, XLogP of 6.45, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-tert-butyl-5,5-dimethylhex-2-enyl)-dimethyl-trimethylsilyloxysilane is sourced from PubChem (CID 123694506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).