C22H15F2N3O — CID 123694591
6-tert-butyl-3,17-difluoro-22-oxa-5,7,15-triazahexacyclo[17.2.1.02,18.04,16.05,14.08,13]docosa-1,3,6,8,10,12,14,16,18,20-decaene (PubChem CID 123694591) has the molecular formula C22H15F2N3O and a molecular weight of 375.38 g/mol. Its IUPAC name is 6-tert-butyl-3,17-difluoro-22-oxa-5,7,15-triazahexacyclo[17.2.1.02,18.04,16.05,14.08,13]docosa-1,3,6,8,10,12,14,16,18,20-decaene.
| Compound Name | 6-tert-butyl-3,17-difluoro-22-oxa-5,7,15-triazahexacyclo[17.2.1.02,18.04,16.05,14.08,13]docosa-1,3,6,8,10,12,14,16,18,20-decaene |
|---|---|
| PubChem CID | 123694591 |
| Molecular Formula | C22H15F2N3O |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 6-tert-butyl-3,17-difluoro-22-oxa-5,7,15-triazahexacyclo[17.2.1.02,18.04,16.05,14.08,13]docosa-1,3,6,8,10,12,14,16,18,20-decaene |
| SMILES | CC(C)(C)c1nc2ccccc2c2nc3c(F)c4c5ccc(o5)c4c(F)c3n12 |
| InChI | InChI=1S/C22H15F2N3O/c1-22(2,3)21-25-11-7-5-4-6-10(11)20-26-18-16(23)14-12-8-9-13(28-12)15(14)17(24)19(18)27(20)21/h4-9H,1-3H3 |
| InChIKey | ORROETYQEBILAQ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 43.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |