C19H19N5O2 — CID 123694862
1-(3-imidazol-1-ylpropyl)-4-phenyl-5-(1H-pyrazol-5-yl)pyrrolidine-2,3-dione (PubChem CID 123694862) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is 1-(3-imidazol-1-ylpropyl)-4-phenyl-5-(1H-pyrazol-5-yl)pyrrolidine-2,3-dione.
| Compound Name | 1-(3-imidazol-1-ylpropyl)-4-phenyl-5-(1H-pyrazol-5-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 123694862 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 1-(3-imidazol-1-ylpropyl)-4-phenyl-5-(1H-pyrazol-5-yl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(CCCn2ccnc2)C(c2ccn[nH]2)C1c1ccccc1 |
| InChI | InChI=1S/C19H19N5O2/c25-18-16(14-5-2-1-3-6-14)17(15-7-8-21-22-15)24(19(18)26)11-4-10-23-12-9-20-13-23/h1-3,5-9,12-13,16-17H,4,10-11H2,(H,21,22) |
| InChIKey | OUBVJQGPRJLHMN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|