About 3-(aziridin-1-yl)-3,5,5-trimethylcyclohexan-1-one
3-(aziridin-1-yl)-3,5,5-trimethylcyclohexan-1-one (PubChem CID 123695050) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is 3-(aziridin-1-yl)-3,5,5-trimethylcyclohexan-1-one.
Molecular Properties
| Compound Name | 3-(aziridin-1-yl)-3,5,5-trimethylcyclohexan-1-one |
| PubChem CID | 123695050 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 3-(aziridin-1-yl)-3,5,5-trimethylcyclohexan-1-one |
| SMILES | CC1(C)CC(=O)CC(C)(N2CC2)C1 |
| InChI | InChI=1S/C11H19NO/c1-10(2)6-9(13)7-11(3,8-10)12-4-5-12/h4-8H2,1-3H3 |
| InChIKey | VDEVBMZSOTVQGG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-(aziridin-1-yl)-3,5,5-trimethylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aziridin-1-yl)-3,5,5-trimethylcyclohexan-1-one?
The IUPAC name of 3-(aziridin-1-yl)-3,5,5-trimethylcyclohexan-1-one (CID 123695050) is 3-(aziridin-1-yl)-3,5,5-trimethylcyclohexan-1-one.
What is the SMILES notation for 3-(aziridin-1-yl)-3,5,5-trimethylcyclohexan-1-one?
The canonical SMILES for 3-(aziridin-1-yl)-3,5,5-trimethylcyclohexan-1-one is CC1(C)CC(=O)CC(C)(N2CC2)C1.
What is the InChIKey of 3-(aziridin-1-yl)-3,5,5-trimethylcyclohexan-1-one?
The InChIKey is VDEVBMZSOTVQGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO/c1-10(2)6-9(13)7-11(3,8-10)12-4-5-12/h4-8H2,1-3H3.
What are the key properties of 3-(aziridin-1-yl)-3,5,5-trimethylcyclohexan-1-one?
3-(aziridin-1-yl)-3,5,5-trimethylcyclohexan-1-one has a molecular weight of 181.28 g/mol, XLogP of 1.84, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aziridin-1-yl)-3,5,5-trimethylcyclohexan-1-one is sourced from PubChem (CID 123695050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).