About methyl-(5-methylhexa-2,4-dien-2-yl)-methylideneazanium
methyl-(5-methylhexa-2,4-dien-2-yl)-methylideneazanium (PubChem CID 123695063) has the molecular formula C9H16N+
and a molecular weight of 138.23 g/mol. Its IUPAC name is methyl-(5-methylhexa-2,4-dien-2-yl)-methylideneazanium.
Molecular Properties
| Compound Name | methyl-(5-methylhexa-2,4-dien-2-yl)-methylideneazanium |
| PubChem CID | 123695063 |
| Molecular Formula | C9H16N+ |
| Molecular Weight | 138.23 g/mol |
| Exact Mass | 138.13 |
| IUPAC Name | methyl-(5-methylhexa-2,4-dien-2-yl)-methylideneazanium |
| SMILES | C=[N+](C)C(C)=CC=C(C)C |
| InChI | InChI=1S/C9H16N/c1-8(2)6-7-9(3)10(4)5/h6-7H,4H2,1-3,5H3/q+1 |
| InChIKey | IGJRWWQQXMMERP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.23 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze methyl-(5-methylhexa-2,4-dien-2-yl)-methylideneazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-(5-methylhexa-2,4-dien-2-yl)-methylideneazanium?
The IUPAC name of methyl-(5-methylhexa-2,4-dien-2-yl)-methylideneazanium (CID 123695063) is methyl-(5-methylhexa-2,4-dien-2-yl)-methylideneazanium.
What is the SMILES notation for methyl-(5-methylhexa-2,4-dien-2-yl)-methylideneazanium?
The canonical SMILES for methyl-(5-methylhexa-2,4-dien-2-yl)-methylideneazanium is C=[N+](C)C(C)=CC=C(C)C.
What is the InChIKey of methyl-(5-methylhexa-2,4-dien-2-yl)-methylideneazanium?
The InChIKey is IGJRWWQQXMMERP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N/c1-8(2)6-7-9(3)10(4)5/h6-7H,4H2,1-3,5H3/q+1.
What are the key properties of methyl-(5-methylhexa-2,4-dien-2-yl)-methylideneazanium?
methyl-(5-methylhexa-2,4-dien-2-yl)-methylideneazanium has a molecular weight of 138.23 g/mol, XLogP of 2.20, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-(5-methylhexa-2,4-dien-2-yl)-methylideneazanium is sourced from PubChem (CID 123695063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).