C24H38O — CID 123695075
4,11-dimethyl-3-(2,4,6-trimethyl-5-methylidenehept-3-en-3-yl)-2-oxabicyclo[5.5.0]dodeca-1(7),9-diene (PubChem CID 123695075) has the molecular formula C24H38O and a molecular weight of 342.57 g/mol. Its IUPAC name is 4,11-dimethyl-3-(2,4,6-trimethyl-5-methylidenehept-3-en-3-yl)-2-oxabicyclo[5.5.0]dodeca-1(7),9-diene.
| Compound Name | 4,11-dimethyl-3-(2,4,6-trimethyl-5-methylidenehept-3-en-3-yl)-2-oxabicyclo[5.5.0]dodeca-1(7),9-diene |
|---|---|
| PubChem CID | 123695075 |
| Molecular Formula | C24H38O |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.29 |
| IUPAC Name | 4,11-dimethyl-3-(2,4,6-trimethyl-5-methylidenehept-3-en-3-yl)-2-oxabicyclo[5.5.0]dodeca-1(7),9-diene |
| SMILES | C=C(C(C)=C(C(C)C)C1OC2=C(CC=CC(C)C2)CCC1C)C(C)C |
| InChI | InChI=1S/C24H38O/c1-15(2)19(7)20(8)23(16(3)4)24-18(6)12-13-21-11-9-10-17(5)14-22(21)25-24/h9-10,15-18,24H,7,11-14H2,1-6,8H3 |
| InChIKey | XUIKJSLGZSBFGZ-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|