C39H44F2NO2+ — CID 123695301
4-(4-butylphenyl)-8,8-diethyl-3,5-difluoro-10-(4-methoxypent-2-en-2-yloxy)-19-methyl-11-azoniatetracyclo[9.8.0.02,7.012,17]nonadeca-1(11),2,4,6,9,12,14,16,18-nonaene (PubChem CID 123695301) has the molecular formula C39H44F2NO2+ and a molecular weight of 596.78 g/mol. Its IUPAC name is 4-(4-butylphenyl)-8,8-diethyl-3,5-difluoro-10-(4-methoxypent-2-en-2-yloxy)-19-methyl-11-azoniatetracyclo[9.8.0.02,7.012,17]nonadeca-1(11),2,4,6,9,12,14,16,18-nonaene.
| Compound Name | 4-(4-butylphenyl)-8,8-diethyl-3,5-difluoro-10-(4-methoxypent-2-en-2-yloxy)-19-methyl-11-azoniatetracyclo[9.8.0.02,7.012,17]nonadeca-1(11),2,4,6,9,12,14,16,18-nonaene |
|---|---|
| PubChem CID | 123695301 |
| Molecular Formula | C39H44F2NO2+ |
| Molecular Weight | 596.78 g/mol |
| Exact Mass | 596.33 |
| IUPAC Name | 4-(4-butylphenyl)-8,8-diethyl-3,5-difluoro-10-(4-methoxypent-2-en-2-yloxy)-19-methyl-11-azoniatetracyclo[9.8.0.02,7.012,17]nonadeca-1(11),2,4,6,9,12,14,16,18-nonaene |
| SMILES | CCCCc1ccc(-c2c(F)cc3c(c2F)-c2c(C)cc4ccccc4[n+]2C(OC(C)=CC(C)OC)=CC3(CC)CC)cc1 |
| InChI | InChI=1S/C39H44F2NO2/c1-8-11-14-28-17-19-29(20-18-28)35-32(40)23-31-36(37(35)41)38-25(4)21-30-15-12-13-16-33(30)42(38)34(24-39(31,9-2)10-3)44-27(6)22-26(5)43-7/h12-13,15-24,26H,8-11,14H2,1-7H3/q+1 |
| InChIKey | RXJZMNHAXBOCEZ-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.78 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|