C17H12FN3O2+2 — CID 123695352
2-(2-fluoro-4-methylphenyl)imidazo[1,5-a]quinoxaline-5,10-diium-1,3-dione (PubChem CID 123695352) has the molecular formula C17H12FN3O2+2 and a molecular weight of 309.30 g/mol. Its IUPAC name is 2-(2-fluoro-4-methylphenyl)imidazo[1,5-a]quinoxaline-5,10-diium-1,3-dione.
| Compound Name | 2-(2-fluoro-4-methylphenyl)imidazo[1,5-a]quinoxaline-5,10-diium-1,3-dione |
|---|---|
| PubChem CID | 123695352 |
| Molecular Formula | C17H12FN3O2+2 |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 2-(2-fluoro-4-methylphenyl)imidazo[1,5-a]quinoxaline-5,10-diium-1,3-dione |
| SMILES | Cc1ccc(N2C(=O)c3c[nH+]c4ccccc4[n+]3C2=O)c(F)c1 |
| InChI | InChI=1S/C17H11FN3O2/c1-10-6-7-13(11(18)8-10)21-16(22)15-9-19-12-4-2-3-5-14(12)20(15)17(21)23/h2-9H,1H3/q+1/p+1 |
| InChIKey | IVIWPAQGZYKKCX-UHFFFAOYSA-O |
| XLogP | 2.02 |
| TPSA | 55.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|