C28H50O3 — CID 123695519
1-(2-cyclohexylpropan-2-yloxy)-2-[3-(2,2,5,5-tetramethylheptan-4-yl)cyclohexa-1,5-dien-1-yl]oxyethanol (PubChem CID 123695519) has the molecular formula C28H50O3 and a molecular weight of 434.71 g/mol. Its IUPAC name is 1-(2-cyclohexylpropan-2-yloxy)-2-[3-(2,2,5,5-tetramethylheptan-4-yl)cyclohexa-1,5-dien-1-yl]oxyethanol.
| Compound Name | 1-(2-cyclohexylpropan-2-yloxy)-2-[3-(2,2,5,5-tetramethylheptan-4-yl)cyclohexa-1,5-dien-1-yl]oxyethanol |
|---|---|
| PubChem CID | 123695519 |
| Molecular Formula | C28H50O3 |
| Molecular Weight | 434.71 g/mol |
| Exact Mass | 434.38 |
| IUPAC Name | 1-(2-cyclohexylpropan-2-yloxy)-2-[3-(2,2,5,5-tetramethylheptan-4-yl)cyclohexa-1,5-dien-1-yl]oxyethanol |
| SMILES | CCC(C)(C)C(CC(C)(C)C)C1C=C(OCC(O)OC(C)(C)C2CCCCC2)C=CC1 |
| InChI | InChI=1S/C28H50O3/c1-9-27(5,6)24(19-26(2,3)4)21-14-13-17-23(18-21)30-20-25(29)31-28(7,8)22-15-11-10-12-16-22/h13,17-18,21-22,24-25,29H,9-12,14-16,19-20H2,1-8H3 |
| InChIKey | MAQKIEDJDYHHQG-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.71 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|