C18H9Cl3F3NO — CID 123695696
4,4,4-trifluoro-1-(1H-indol-5-yl)-3-(3,4,5-trichlorophenyl)but-2-en-1-one (PubChem CID 123695696) has the molecular formula C18H9Cl3F3NO and a molecular weight of 418.63 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-(1H-indol-5-yl)-3-(3,4,5-trichlorophenyl)but-2-en-1-one.
| Compound Name | 4,4,4-trifluoro-1-(1H-indol-5-yl)-3-(3,4,5-trichlorophenyl)but-2-en-1-one |
|---|---|
| PubChem CID | 123695696 |
| Molecular Formula | C18H9Cl3F3NO |
| Molecular Weight | 418.63 g/mol |
| Exact Mass | 416.97 |
| IUPAC Name | 4,4,4-trifluoro-1-(1H-indol-5-yl)-3-(3,4,5-trichlorophenyl)but-2-en-1-one |
| SMILES | O=C(C=C(c1cc(Cl)c(Cl)c(Cl)c1)C(F)(F)F)c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C18H9Cl3F3NO/c19-13-6-11(7-14(20)17(13)21)12(18(22,23)24)8-16(26)10-1-2-15-9(5-10)3-4-25-15/h1-8,25H |
| InChIKey | FCXNSLWOBFKCPH-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.63 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|