C35H44BrN4O2+ — CID 123696339
1-[2-[3-[(6-bromoquinolin-4-yl)oxymethyl]piperidin-1-yl]propyl]-6-methyl-4-[(1-methylpiperidin-3-yl)methoxy]quinolin-1-ium (PubChem CID 123696339) has the molecular formula C35H44BrN4O2+ and a molecular weight of 632.67 g/mol. Its IUPAC name is 1-[2-[3-[(6-bromoquinolin-4-yl)oxymethyl]piperidin-1-yl]propyl]-6-methyl-4-[(1-methylpiperidin-3-yl)methoxy]quinolin-1-ium.
| Compound Name | 1-[2-[3-[(6-bromoquinolin-4-yl)oxymethyl]piperidin-1-yl]propyl]-6-methyl-4-[(1-methylpiperidin-3-yl)methoxy]quinolin-1-ium |
|---|---|
| PubChem CID | 123696339 |
| Molecular Formula | C35H44BrN4O2+ |
| Molecular Weight | 632.67 g/mol |
| Exact Mass | 631.26 |
| IUPAC Name | 1-[2-[3-[(6-bromoquinolin-4-yl)oxymethyl]piperidin-1-yl]propyl]-6-methyl-4-[(1-methylpiperidin-3-yl)methoxy]quinolin-1-ium |
| SMILES | Cc1ccc2c(c1)c(OCC1CCCN(C)C1)cc[n+]2CC(C)N1CCCC(COc2ccnc3ccc(Br)cc23)C1 |
| InChI | InChI=1S/C35H44BrN4O2/c1-25-8-11-33-31(18-25)35(42-23-27-6-4-15-38(3)21-27)13-17-40(33)20-26(2)39-16-5-7-28(22-39)24-41-34-12-14-37-32-10-9-29(36)19-30(32)34/h8-14,17-19,26-28H,4-7,15-16,20-24H2,1-3H3/q+1 |
| InChIKey | XMVWVEMDPSFHNR-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 41.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.67 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|