About 1-buta-1,3-dien-2-yl-4-(6-fluorohexa-3,5-dienyl)piperidine
1-buta-1,3-dien-2-yl-4-(6-fluorohexa-3,5-dienyl)piperidine (PubChem CID 123697465) has the molecular formula C15H22FN
and a molecular weight of 235.35 g/mol. Its IUPAC name is 1-buta-1,3-dien-2-yl-4-(6-fluorohexa-3,5-dienyl)piperidine.
Molecular Properties
| Compound Name | 1-buta-1,3-dien-2-yl-4-(6-fluorohexa-3,5-dienyl)piperidine |
| PubChem CID | 123697465 |
| Molecular Formula | C15H22FN |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 1-buta-1,3-dien-2-yl-4-(6-fluorohexa-3,5-dienyl)piperidine |
| SMILES | C=CC(=C)N1CCC(CCC=CC=CF)CC1 |
| InChI | InChI=1S/C15H22FN/c1-3-14(2)17-12-9-15(10-13-17)8-6-4-5-7-11-16/h3-5,7,11,15H,1-2,6,8-10,12-13H2 |
| InChIKey | RDMUMAPIJNQOOX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-buta-1,3-dien-2-yl-4-(6-fluorohexa-3,5-dienyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-buta-1,3-dien-2-yl-4-(6-fluorohexa-3,5-dienyl)piperidine?
The IUPAC name of 1-buta-1,3-dien-2-yl-4-(6-fluorohexa-3,5-dienyl)piperidine (CID 123697465) is 1-buta-1,3-dien-2-yl-4-(6-fluorohexa-3,5-dienyl)piperidine.
What is the SMILES notation for 1-buta-1,3-dien-2-yl-4-(6-fluorohexa-3,5-dienyl)piperidine?
The canonical SMILES for 1-buta-1,3-dien-2-yl-4-(6-fluorohexa-3,5-dienyl)piperidine is C=CC(=C)N1CCC(CCC=CC=CF)CC1.
What is the InChIKey of 1-buta-1,3-dien-2-yl-4-(6-fluorohexa-3,5-dienyl)piperidine?
The InChIKey is RDMUMAPIJNQOOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22FN/c1-3-14(2)17-12-9-15(10-13-17)8-6-4-5-7-11-16/h3-5,7,11,15H,1-2,6,8-10,12-13H2.
What are the key properties of 1-buta-1,3-dien-2-yl-4-(6-fluorohexa-3,5-dienyl)piperidine?
1-buta-1,3-dien-2-yl-4-(6-fluorohexa-3,5-dienyl)piperidine has a molecular weight of 235.35 g/mol, XLogP of 4.22, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-buta-1,3-dien-2-yl-4-(6-fluorohexa-3,5-dienyl)piperidine is sourced from PubChem (CID 123697465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).