C14H16 — CID 123697473
5-hepta-3,5-dien-3-ylcyclohepta-1,2,4,6-tetraene (PubChem CID 123697473) has the molecular formula C14H16 and a molecular weight of 184.28 g/mol. Its IUPAC name is 5-hepta-3,5-dien-3-ylcyclohepta-1,2,4,6-tetraene.
| Compound Name | 5-hepta-3,5-dien-3-ylcyclohepta-1,2,4,6-tetraene |
|---|---|
| PubChem CID | 123697473 |
| Molecular Formula | C14H16 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 5-hepta-3,5-dien-3-ylcyclohepta-1,2,4,6-tetraene |
| SMILES | CC=CC=C(CC)C1=CC=C=CC=C1 |
| InChI | InChI=1S/C14H16/c1-3-5-10-13(4-2)14-11-8-6-7-9-12-14/h3,5-6,8-12H,4H2,1-2H3 |
| InChIKey | BYEJQKQSUWRGHK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|