C11H18N2O — CID 123697815
4-(4,5-dimethylpyrazol-1-yl)cyclohexan-1-ol (PubChem CID 123697815) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 4-(4,5-dimethylpyrazol-1-yl)cyclohexan-1-ol.
| Compound Name | 4-(4,5-dimethylpyrazol-1-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 123697815 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 4-(4,5-dimethylpyrazol-1-yl)cyclohexan-1-ol |
| SMILES | Cc1cnn(C2CCC(O)CC2)c1C |
| InChI | InChI=1S/C11H18N2O/c1-8-7-12-13(9(8)2)10-3-5-11(14)6-4-10/h7,10-11,14H,3-6H2,1-2H3 |
| InChIKey | HPKDMCASGVFGLC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |