About (2,6-dimethoxycyclohexa-2,4-dien-1-yl)methanamine
(2,6-dimethoxycyclohexa-2,4-dien-1-yl)methanamine (PubChem CID 123697876) has the molecular formula C9H15NO2
and a molecular weight of 169.22 g/mol. Its IUPAC name is (2,6-dimethoxycyclohexa-2,4-dien-1-yl)methanamine.
Molecular Properties
| Compound Name | (2,6-dimethoxycyclohexa-2,4-dien-1-yl)methanamine |
| PubChem CID | 123697876 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | (2,6-dimethoxycyclohexa-2,4-dien-1-yl)methanamine |
| SMILES | COC1=CC=CC(OC)C1CN |
| InChI | InChI=1S/C9H15NO2/c1-11-8-4-3-5-9(12-2)7(8)6-10/h3-5,7-8H,6,10H2,1-2H3 |
| InChIKey | SDFKTDNSSDSESO-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2,6-dimethoxycyclohexa-2,4-dien-1-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dimethoxycyclohexa-2,4-dien-1-yl)methanamine?
The IUPAC name of (2,6-dimethoxycyclohexa-2,4-dien-1-yl)methanamine (CID 123697876) is (2,6-dimethoxycyclohexa-2,4-dien-1-yl)methanamine.
What is the SMILES notation for (2,6-dimethoxycyclohexa-2,4-dien-1-yl)methanamine?
The canonical SMILES for (2,6-dimethoxycyclohexa-2,4-dien-1-yl)methanamine is COC1=CC=CC(OC)C1CN.
What is the InChIKey of (2,6-dimethoxycyclohexa-2,4-dien-1-yl)methanamine?
The InChIKey is SDFKTDNSSDSESO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2/c1-11-8-4-3-5-9(12-2)7(8)6-10/h3-5,7-8H,6,10H2,1-2H3.
What are the key properties of (2,6-dimethoxycyclohexa-2,4-dien-1-yl)methanamine?
(2,6-dimethoxycyclohexa-2,4-dien-1-yl)methanamine has a molecular weight of 169.22 g/mol, XLogP of 0.68, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dimethoxycyclohexa-2,4-dien-1-yl)methanamine is sourced from PubChem (CID 123697876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).