C10H15F2O2P — CID 123698256
phosphanyl 2,3-difluoro-3-methyl-2-prop-1-enylhex-5-enoate (PubChem CID 123698256) has the molecular formula C10H15F2O2P and a molecular weight of 236.20 g/mol. Its IUPAC name is phosphanyl 2,3-difluoro-3-methyl-2-prop-1-enylhex-5-enoate.
| Compound Name | phosphanyl 2,3-difluoro-3-methyl-2-prop-1-enylhex-5-enoate |
|---|---|
| PubChem CID | 123698256 |
| Molecular Formula | C10H15F2O2P |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | phosphanyl 2,3-difluoro-3-methyl-2-prop-1-enylhex-5-enoate |
| SMILES | C=CCC(C)(F)C(F)(C=CC)C(=O)OP |
| InChI | InChI=1S/C10H15F2O2P/c1-4-6-9(3,11)10(12,7-5-2)8(13)14-15/h4-5,7H,1,6,15H2,2-3H3 |
| InChIKey | UNBPBNKEYDBQQD-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|