About 4-methyl-1,3-benzoxazole;7-methyl-3H-indole;4-methyl-1H-isoindole
4-methyl-1,3-benzoxazole;7-methyl-3H-indole;4-methyl-1H-isoindole (PubChem CID 123698298) has the molecular formula C26H25N3O
and a molecular weight of 395.51 g/mol. Its IUPAC name is 4-methyl-1,3-benzoxazole;7-methyl-3H-indole;4-methyl-1H-isoindole.
Molecular Properties
| Compound Name | 4-methyl-1,3-benzoxazole;7-methyl-3H-indole;4-methyl-1H-isoindole |
| PubChem CID | 123698298 |
| Molecular Formula | C26H25N3O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 4-methyl-1,3-benzoxazole;7-methyl-3H-indole;4-methyl-1H-isoindole |
| SMILES | Cc1cccc2c1C=NC2.Cc1cccc2c1N=CC2.Cc1cccc2ocnc12 |
| InChI | InChI=1S/2C9H9N.C8H7NO/c1-7-3-2-4-8-5-10-6-9(7)8;1-7-3-2-4-8-5-6-10-9(7)8;1-6-3-2-4-7-8(6)9-5-10-7/h2*2-4,6H,5H2,1H3;2-5H,1H3 |
| InChIKey | ORGFELFETCIBDO-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 50.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-1,3-benzoxazole;7-methyl-3H-indole;4-methyl-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,3-benzoxazole;7-methyl-3H-indole;4-methyl-1H-isoindole?
The IUPAC name of 4-methyl-1,3-benzoxazole;7-methyl-3H-indole;4-methyl-1H-isoindole (CID 123698298) is 4-methyl-1,3-benzoxazole;7-methyl-3H-indole;4-methyl-1H-isoindole.
What is the SMILES notation for 4-methyl-1,3-benzoxazole;7-methyl-3H-indole;4-methyl-1H-isoindole?
The canonical SMILES for 4-methyl-1,3-benzoxazole;7-methyl-3H-indole;4-methyl-1H-isoindole is Cc1cccc2c1C=NC2.Cc1cccc2c1N=CC2.Cc1cccc2ocnc12.
What is the InChIKey of 4-methyl-1,3-benzoxazole;7-methyl-3H-indole;4-methyl-1H-isoindole?
The InChIKey is ORGFELFETCIBDO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H9N.C8H7NO/c1-7-3-2-4-8-5-10-6-9(7)8;1-7-3-2-4-8-5-6-10-9(7)8;1-6-3-2-4-7-8(6)9-5-10-7/h2*2-4,6H,5H2,1H3;2-5H,1H3.
What are the key properties of 4-methyl-1,3-benzoxazole;7-methyl-3H-indole;4-methyl-1H-isoindole?
4-methyl-1,3-benzoxazole;7-methyl-3H-indole;4-methyl-1H-isoindole has a molecular weight of 395.51 g/mol, XLogP of 6.32, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,3-benzoxazole;7-methyl-3H-indole;4-methyl-1H-isoindole is sourced from PubChem (CID 123698298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).