About [1-[4-(4,4-difluorocyclohexyl)oxyphenyl]cyclopropyl] N-(1-azabicyclo[2.2.2]octan-3-yl)carbamate
[1-[4-(4,4-difluorocyclohexyl)oxyphenyl]cyclopropyl] N-(1-azabicyclo[2.2.2]octan-3-yl)carbamate (PubChem CID 123698953) has the molecular formula C23H30F2N2O3
and a molecular weight of 420.50 g/mol. Its IUPAC name is [1-[4-(4,4-difluorocyclohexyl)oxyphenyl]cyclopropyl] N-(1-azabicyclo[2.2.2]octan-3-yl)carbamate.
Molecular Properties
| Compound Name | [1-[4-(4,4-difluorocyclohexyl)oxyphenyl]cyclopropyl] N-(1-azabicyclo[2.2.2]octan-3-yl)carbamate |
| PubChem CID | 123698953 |
| Molecular Formula | C23H30F2N2O3 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | [1-[4-(4,4-difluorocyclohexyl)oxyphenyl]cyclopropyl] N-(1-azabicyclo[2.2.2]octan-3-yl)carbamate |
| SMILES | O=C(NC1CN2CCC1CC2)OC1(c2ccc(OC3CCC(F)(F)CC3)cc2)CC1 |
| InChI | InChI=1S/C23H30F2N2O3/c24-23(25)9-5-19(6-10-23)29-18-3-1-17(2-4-18)22(11-12-22)30-21(28)26-20-15-27-13-7-16(20)8-14-27/h1-4,16,19-20H,5-15H2,(H,26,28) |
| InChIKey | XZHOHWRIYOGYPG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[4-(4,4-difluorocyclohexyl)oxyphenyl]cyclopropyl] N-(1-azabicyclo[2.2.2]octan-3-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-(4,4-difluorocyclohexyl)oxyphenyl]cyclopropyl] N-(1-azabicyclo[2.2.2]octan-3-yl)carbamate?
The IUPAC name of [1-[4-(4,4-difluorocyclohexyl)oxyphenyl]cyclopropyl] N-(1-azabicyclo[2.2.2]octan-3-yl)carbamate (CID 123698953) is [1-[4-(4,4-difluorocyclohexyl)oxyphenyl]cyclopropyl] N-(1-azabicyclo[2.2.2]octan-3-yl)carbamate.
What is the SMILES notation for [1-[4-(4,4-difluorocyclohexyl)oxyphenyl]cyclopropyl] N-(1-azabicyclo[2.2.2]octan-3-yl)carbamate?
The canonical SMILES for [1-[4-(4,4-difluorocyclohexyl)oxyphenyl]cyclopropyl] N-(1-azabicyclo[2.2.2]octan-3-yl)carbamate is O=C(NC1CN2CCC1CC2)OC1(c2ccc(OC3CCC(F)(F)CC3)cc2)CC1.
What is the InChIKey of [1-[4-(4,4-difluorocyclohexyl)oxyphenyl]cyclopropyl] N-(1-azabicyclo[2.2.2]octan-3-yl)carbamate?
The InChIKey is XZHOHWRIYOGYPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30F2N2O3/c24-23(25)9-5-19(6-10-23)29-18-3-1-17(2-4-18)22(11-12-22)30-21(28)26-20-15-27-13-7-16(20)8-14-27/h1-4,16,19-20H,5-15H2,(H,26,28).
What are the key properties of [1-[4-(4,4-difluorocyclohexyl)oxyphenyl]cyclopropyl] N-(1-azabicyclo[2.2.2]octan-3-yl)carbamate?
[1-[4-(4,4-difluorocyclohexyl)oxyphenyl]cyclopropyl] N-(1-azabicyclo[2.2.2]octan-3-yl)carbamate has a molecular weight of 420.50 g/mol, XLogP of 4.45, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-(4,4-difluorocyclohexyl)oxyphenyl]cyclopropyl] N-(1-azabicyclo[2.2.2]octan-3-yl)carbamate is sourced from PubChem (CID 123698953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).