C19H20N6O — CID 123699015
2-(2-cyclopropylaziridin-1-yl)-4-[(1-methylindol-4-yl)amino]pyrimidine-5-carboxamide (PubChem CID 123699015) has the molecular formula C19H20N6O and a molecular weight of 348.41 g/mol. Its IUPAC name is 2-(2-cyclopropylaziridin-1-yl)-4-[(1-methylindol-4-yl)amino]pyrimidine-5-carboxamide.
| Compound Name | 2-(2-cyclopropylaziridin-1-yl)-4-[(1-methylindol-4-yl)amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 123699015 |
| Molecular Formula | C19H20N6O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-(2-cyclopropylaziridin-1-yl)-4-[(1-methylindol-4-yl)amino]pyrimidine-5-carboxamide |
| SMILES | Cn1ccc2c(Nc3nc(N4CC4C4CC4)ncc3C(N)=O)cccc21 |
| InChI | InChI=1S/C19H20N6O/c1-24-8-7-12-14(3-2-4-15(12)24)22-18-13(17(20)26)9-21-19(23-18)25-10-16(25)11-5-6-11/h2-4,7-9,11,16H,5-6,10H2,1H3,(H2,20,26)(H,21,22,23) |
| InChIKey | DKRQSXMAECLHOJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|