C22H26ClN5O5S — CID 123699446
(3-chloro-5-methylsulfonylphenyl)methyl 2-(4,5,6,7-tetrahydro-2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 123699446) has the molecular formula C22H26ClN5O5S and a molecular weight of 508.00 g/mol. Its IUPAC name is (3-chloro-5-methylsulfonylphenyl)methyl 2-(4,5,6,7-tetrahydro-2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | (3-chloro-5-methylsulfonylphenyl)methyl 2-(4,5,6,7-tetrahydro-2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 123699446 |
| Molecular Formula | C22H26ClN5O5S |
| Molecular Weight | 508.00 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | (3-chloro-5-methylsulfonylphenyl)methyl 2-(4,5,6,7-tetrahydro-2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | CS(=O)(=O)c1cc(Cl)cc(COC(=O)N2CC3CN(C(=O)C4CCc5n[nH]nc5C4)CC3C2)c1 |
| InChI | InChI=1S/C22H26ClN5O5S/c1-34(31,32)18-5-13(4-17(23)7-18)12-33-22(30)28-10-15-8-27(9-16(15)11-28)21(29)14-2-3-19-20(6-14)25-26-24-19/h4-5,7,14-16H,2-3,6,8-12H2,1H3,(H,24,25,26) |
| InChIKey | JSKWBCBMSDDSMV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 125.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.00 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |