C10H16N2O2 — CID 123699570
2-N-ethylcyclohex-4-ene-1,2-dicarboxamide (PubChem CID 123699570) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-N-ethylcyclohex-4-ene-1,2-dicarboxamide.
| Compound Name | 2-N-ethylcyclohex-4-ene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 123699570 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 2-N-ethylcyclohex-4-ene-1,2-dicarboxamide |
| SMILES | CCNC(=O)C1CC=CCC1C(N)=O |
| InChI | InChI=1S/C10H16N2O2/c1-2-12-10(14)8-6-4-3-5-7(8)9(11)13/h3-4,7-8H,2,5-6H2,1H3,(H2,11,13)(H,12,14) |
| InChIKey | ZRTOWOWSNDUXHF-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|