C24H21N3O3S — CID 123699802
5-[[5-(2-hexa-2,4-dien-3-yl-1,3-thiazol-4-yl)-2-oxo-1H-indol-3-ylidene]methyl]-4-methyl-1H-pyrrole-2-carboxylic acid (PubChem CID 123699802) has the molecular formula C24H21N3O3S and a molecular weight of 431.52 g/mol. Its IUPAC name is 5-[[5-(2-hexa-2,4-dien-3-yl-1,3-thiazol-4-yl)-2-oxo-1H-indol-3-ylidene]methyl]-4-methyl-1H-pyrrole-2-carboxylic acid.
| Compound Name | 5-[[5-(2-hexa-2,4-dien-3-yl-1,3-thiazol-4-yl)-2-oxo-1H-indol-3-ylidene]methyl]-4-methyl-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 123699802 |
| Molecular Formula | C24H21N3O3S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 5-[[5-(2-hexa-2,4-dien-3-yl-1,3-thiazol-4-yl)-2-oxo-1H-indol-3-ylidene]methyl]-4-methyl-1H-pyrrole-2-carboxylic acid |
| SMILES | CC=CC(=CC)c1nc(-c2ccc3c(c2)C(=Cc2[nH]c(C(=O)O)cc2C)C(=O)N3)cs1 |
| InChI | InChI=1S/C24H21N3O3S/c1-4-6-14(5-2)23-27-21(12-31-23)15-7-8-18-16(10-15)17(22(28)26-18)11-19-13(3)9-20(25-19)24(29)30/h4-12,25H,1-3H3,(H,26,28)(H,29,30) |
| InChIKey | LKGFRBBVSWIIPJ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|