About 2-methyl-3-oxo-1,2-dihydroindene-5-sulfinate
2-methyl-3-oxo-1,2-dihydroindene-5-sulfinate (PubChem CID 123699882) has the molecular formula C10H9O3S-
and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-methyl-3-oxo-1,2-dihydroindene-5-sulfinate.
Molecular Properties
| Compound Name | 2-methyl-3-oxo-1,2-dihydroindene-5-sulfinate |
| PubChem CID | 123699882 |
| Molecular Formula | C10H9O3S- |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 2-methyl-3-oxo-1,2-dihydroindene-5-sulfinate |
| SMILES | CC1Cc2ccc(S(=O)[O-])cc2C1=O |
| InChI | InChI=1S/C10H10O3S/c1-6-4-7-2-3-8(14(12)13)5-9(7)10(6)11/h2-3,5-6H,4H2,1H3,(H,12,13)/p-1 |
| InChIKey | HAUNJXJGAUDXDZ-UHFFFAOYSA-M |
| XLogP | 1.30 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3-oxo-1,2-dihydroindene-5-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-oxo-1,2-dihydroindene-5-sulfinate?
The IUPAC name of 2-methyl-3-oxo-1,2-dihydroindene-5-sulfinate (CID 123699882) is 2-methyl-3-oxo-1,2-dihydroindene-5-sulfinate.
What is the SMILES notation for 2-methyl-3-oxo-1,2-dihydroindene-5-sulfinate?
The canonical SMILES for 2-methyl-3-oxo-1,2-dihydroindene-5-sulfinate is CC1Cc2ccc(S(=O)[O-])cc2C1=O.
What is the InChIKey of 2-methyl-3-oxo-1,2-dihydroindene-5-sulfinate?
The InChIKey is HAUNJXJGAUDXDZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H10O3S/c1-6-4-7-2-3-8(14(12)13)5-9(7)10(6)11/h2-3,5-6H,4H2,1H3,(H,12,13)/p-1.
What are the key properties of 2-methyl-3-oxo-1,2-dihydroindene-5-sulfinate?
2-methyl-3-oxo-1,2-dihydroindene-5-sulfinate has a molecular weight of 209.25 g/mol, XLogP of 1.30, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-oxo-1,2-dihydroindene-5-sulfinate is sourced from PubChem (CID 123699882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).