C21H18F2N4O2 — CID 123700192
ethyl 5-[(2R,4S)-4-fluoro-2-(3-fluoro-5-isocyanophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyridine-3-carboxylate (PubChem CID 123700192) has the molecular formula C21H18F2N4O2 and a molecular weight of 396.40 g/mol. Its IUPAC name is ethyl 5-[(2R,4S)-4-fluoro-2-(3-fluoro-5-isocyanophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyridine-3-carboxylate.
| Compound Name | ethyl 5-[(2R,4S)-4-fluoro-2-(3-fluoro-5-isocyanophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 123700192 |
| Molecular Formula | C21H18F2N4O2 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | ethyl 5-[(2R,4S)-4-fluoro-2-(3-fluoro-5-isocyanophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyridine-3-carboxylate |
| SMILES | [C-]#[N+]c1cc(F)cc([C@H]2C[C@H](F)CN2c2ccn3ncc(C(=O)OCC)c3c2)c1 |
| InChI | InChI=1S/C21H18F2N4O2/c1-3-29-21(28)18-11-25-27-5-4-17(10-20(18)27)26-12-15(23)9-19(26)13-6-14(22)8-16(7-13)24-2/h4-8,10-11,15,19H,3,9,12H2,1H3/t15-,19+/m0/s1 |
| InChIKey | GDYUZKKRAHEXMQ-HNAYVOBHSA-N |
| XLogP | 4.49 |
| TPSA | 51.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|