About ethyl 3-iminobutanimidate
ethyl 3-iminobutanimidate (PubChem CID 123700994) has the molecular formula C6H12N2O
and a molecular weight of 128.17 g/mol. Its IUPAC name is ethyl 3-iminobutanimidate.
Molecular Properties
| Compound Name | ethyl 3-iminobutanimidate |
| PubChem CID | 123700994 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | ethyl 3-iminobutanimidate |
| SMILES | [H]/N=C(/C/C(C)=N/[H])OCC |
| InChI | InChI=1S/C6H12N2O/c1-3-9-6(8)4-5(2)7/h7-8H,3-4H2,1-2H3/b7-5+,8-6- |
| InChIKey | MSTFZCZGXAAXNK-YMBWGVAGSA-N |
| XLogP | 1.43 |
| TPSA | 56.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-iminobutanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-iminobutanimidate?
The IUPAC name of ethyl 3-iminobutanimidate (CID 123700994) is ethyl 3-iminobutanimidate.
What is the SMILES notation for ethyl 3-iminobutanimidate?
The canonical SMILES for ethyl 3-iminobutanimidate is [H]/N=C(/C/C(C)=N/[H])OCC.
What is the InChIKey of ethyl 3-iminobutanimidate?
The InChIKey is MSTFZCZGXAAXNK-YMBWGVAGSA-N. The full InChI is InChI=1S/C6H12N2O/c1-3-9-6(8)4-5(2)7/h7-8H,3-4H2,1-2H3/b7-5+,8-6-.
What are the key properties of ethyl 3-iminobutanimidate?
ethyl 3-iminobutanimidate has a molecular weight of 128.17 g/mol, XLogP of 1.43, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-iminobutanimidate is sourced from PubChem (CID 123700994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).