C17H28O2 — CID 123701066
1,1,2,2,3,3,6-heptamethyl-3a,4,7,7a-tetrahydroindene-5-carboxylic acid (PubChem CID 123701066) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 1,1,2,2,3,3,6-heptamethyl-3a,4,7,7a-tetrahydroindene-5-carboxylic acid.
| Compound Name | 1,1,2,2,3,3,6-heptamethyl-3a,4,7,7a-tetrahydroindene-5-carboxylic acid |
|---|---|
| PubChem CID | 123701066 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 1,1,2,2,3,3,6-heptamethyl-3a,4,7,7a-tetrahydroindene-5-carboxylic acid |
| SMILES | CC1=C(C(=O)O)CC2C(C1)C(C)(C)C(C)(C)C2(C)C |
| InChI | InChI=1S/C17H28O2/c1-10-8-12-13(9-11(10)14(18)19)16(4,5)17(6,7)15(12,2)3/h12-13H,8-9H2,1-7H3,(H,18,19) |
| InChIKey | FHUNMKFFIOGCJY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |