About 5-chloro-2,4-dihydroxy-6-methyl-3-(7-methylocta-2,6-dienyl)benzaldehyde
5-chloro-2,4-dihydroxy-6-methyl-3-(7-methylocta-2,6-dienyl)benzaldehyde (PubChem CID 123701878) has the molecular formula C17H21ClO3
and a molecular weight of 308.81 g/mol. Its IUPAC name is 5-chloro-2,4-dihydroxy-6-methyl-3-(7-methylocta-2,6-dienyl)benzaldehyde.
Molecular Properties
| Compound Name | 5-chloro-2,4-dihydroxy-6-methyl-3-(7-methylocta-2,6-dienyl)benzaldehyde |
| PubChem CID | 123701878 |
| Molecular Formula | C17H21ClO3 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 5-chloro-2,4-dihydroxy-6-methyl-3-(7-methylocta-2,6-dienyl)benzaldehyde |
| SMILES | CC(C)=CCCC=CCc1c(O)c(Cl)c(C)c(C=O)c1O |
| InChI | InChI=1S/C17H21ClO3/c1-11(2)8-6-4-5-7-9-13-16(20)14(10-19)12(3)15(18)17(13)21/h5,7-8,10,20-21H,4,6,9H2,1-3H3 |
| InChIKey | VAUWGLXQIMCQPV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2,4-dihydroxy-6-methyl-3-(7-methylocta-2,6-dienyl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2,4-dihydroxy-6-methyl-3-(7-methylocta-2,6-dienyl)benzaldehyde?
The IUPAC name of 5-chloro-2,4-dihydroxy-6-methyl-3-(7-methylocta-2,6-dienyl)benzaldehyde (CID 123701878) is 5-chloro-2,4-dihydroxy-6-methyl-3-(7-methylocta-2,6-dienyl)benzaldehyde.
What is the SMILES notation for 5-chloro-2,4-dihydroxy-6-methyl-3-(7-methylocta-2,6-dienyl)benzaldehyde?
The canonical SMILES for 5-chloro-2,4-dihydroxy-6-methyl-3-(7-methylocta-2,6-dienyl)benzaldehyde is CC(C)=CCCC=CCc1c(O)c(Cl)c(C)c(C=O)c1O.
What is the InChIKey of 5-chloro-2,4-dihydroxy-6-methyl-3-(7-methylocta-2,6-dienyl)benzaldehyde?
The InChIKey is VAUWGLXQIMCQPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21ClO3/c1-11(2)8-6-4-5-7-9-13-16(20)14(10-19)12(3)15(18)17(13)21/h5,7-8,10,20-21H,4,6,9H2,1-3H3.
What are the key properties of 5-chloro-2,4-dihydroxy-6-methyl-3-(7-methylocta-2,6-dienyl)benzaldehyde?
5-chloro-2,4-dihydroxy-6-methyl-3-(7-methylocta-2,6-dienyl)benzaldehyde has a molecular weight of 308.81 g/mol, XLogP of 4.72, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2,4-dihydroxy-6-methyl-3-(7-methylocta-2,6-dienyl)benzaldehyde is sourced from PubChem (CID 123701878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).