About 5-benzyl-1,2,4-thiadiazole
5-benzyl-1,2,4-thiadiazole (PubChem CID 123702348) has the molecular formula C9H8N2S
and a molecular weight of 176.24 g/mol. Its IUPAC name is 5-benzyl-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 5-benzyl-1,2,4-thiadiazole |
| PubChem CID | 123702348 |
| Molecular Formula | C9H8N2S |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | 5-benzyl-1,2,4-thiadiazole |
| SMILES | c1ccc(Cc2ncns2)cc1 |
| InChI | InChI=1S/C9H8N2S/c1-2-4-8(5-3-1)6-9-10-7-11-12-9/h1-5,7H,6H2 |
| InChIKey | BYQNYUQSZCMEPG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-benzyl-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-1,2,4-thiadiazole?
The IUPAC name of 5-benzyl-1,2,4-thiadiazole (CID 123702348) is 5-benzyl-1,2,4-thiadiazole.
What is the SMILES notation for 5-benzyl-1,2,4-thiadiazole?
The canonical SMILES for 5-benzyl-1,2,4-thiadiazole is c1ccc(Cc2ncns2)cc1.
What is the InChIKey of 5-benzyl-1,2,4-thiadiazole?
The InChIKey is BYQNYUQSZCMEPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2S/c1-2-4-8(5-3-1)6-9-10-7-11-12-9/h1-5,7H,6H2.
What are the key properties of 5-benzyl-1,2,4-thiadiazole?
5-benzyl-1,2,4-thiadiazole has a molecular weight of 176.24 g/mol, XLogP of 2.13, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-1,2,4-thiadiazole is sourced from PubChem (CID 123702348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).