C27H44O5 — CID 123703539
propan-2-yl 7-[(2S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoate (PubChem CID 123703539) has the molecular formula C27H44O5 and a molecular weight of 448.64 g/mol. Its IUPAC name is propan-2-yl 7-[(2S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoate.
| Compound Name | propan-2-yl 7-[(2S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 123703539 |
| Molecular Formula | C27H44O5 |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | propan-2-yl 7-[(2S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoate |
| SMILES | CCCCCCCC1(CC[C@H]2C=CC(=O)C2CC=CCCCC(=O)OC(C)C)OCCO1 |
| InChI | InChI=1S/C27H44O5/c1-4-5-6-9-12-18-27(30-20-21-31-27)19-17-23-15-16-25(28)24(23)13-10-7-8-11-14-26(29)32-22(2)3/h7,10,15-16,22-24H,4-6,8-9,11-14,17-21H2,1-3H3/t23-,24?/m1/s1 |
| InChIKey | IUZBXZZGMFPWCE-MIHMCVIASA-N |
| XLogP | 6.31 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|