C27H25Cl2N5OS2 — CID 123704135
1'-[3-(3,4-dichlorophenyl)prop-2-enyl]-N-(1,3-thiazol-4-ylmethyl)spiro[7H-pyrrolo[3,2-e][1,3]benzothiazole-8,4'-piperidine]-6-carboxamide (PubChem CID 123704135) has the molecular formula C27H25Cl2N5OS2 and a molecular weight of 570.57 g/mol. Its IUPAC name is 1'-[3-(3,4-dichlorophenyl)prop-2-enyl]-N-(1,3-thiazol-4-ylmethyl)spiro[7H-pyrrolo[3,2-e][1,3]benzothiazole-8,4'-piperidine]-6-carboxamide.
| Compound Name | 1'-[3-(3,4-dichlorophenyl)prop-2-enyl]-N-(1,3-thiazol-4-ylmethyl)spiro[7H-pyrrolo[3,2-e][1,3]benzothiazole-8,4'-piperidine]-6-carboxamide |
|---|---|
| PubChem CID | 123704135 |
| Molecular Formula | C27H25Cl2N5OS2 |
| Molecular Weight | 570.57 g/mol |
| Exact Mass | 569.09 |
| IUPAC Name | 1'-[3-(3,4-dichlorophenyl)prop-2-enyl]-N-(1,3-thiazol-4-ylmethyl)spiro[7H-pyrrolo[3,2-e][1,3]benzothiazole-8,4'-piperidine]-6-carboxamide |
| SMILES | O=C(NCc1cscn1)N1CC2(CCN(CC=Cc3ccc(Cl)c(Cl)c3)CC2)c2c1ccc1scnc21 |
| InChI | InChI=1S/C27H25Cl2N5OS2/c28-20-4-3-18(12-21(20)29)2-1-9-33-10-7-27(8-11-33)15-34(26(35)30-13-19-14-36-16-31-19)22-5-6-23-25(24(22)27)32-17-37-23/h1-6,12,14,16-17H,7-11,13,15H2,(H,30,35) |
| InChIKey | XYZLPOFJSRIJEG-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.57 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |