C13H16F2N6O — CID 123704475
4-(2,2-difluoroethoxy)-N-(1,5-dimethylpyrazol-4-yl)-5-(methyliminomethyl)pyrimidin-2-amine (PubChem CID 123704475) has the molecular formula C13H16F2N6O and a molecular weight of 310.31 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-N-(1,5-dimethylpyrazol-4-yl)-5-(methyliminomethyl)pyrimidin-2-amine.
| Compound Name | 4-(2,2-difluoroethoxy)-N-(1,5-dimethylpyrazol-4-yl)-5-(methyliminomethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 123704475 |
| Molecular Formula | C13H16F2N6O |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-N-(1,5-dimethylpyrazol-4-yl)-5-(methyliminomethyl)pyrimidin-2-amine |
| SMILES | C/N=C/c1cnc(Nc2cnn(C)c2C)nc1OCC(F)F |
| InChI | InChI=1S/C13H16F2N6O/c1-8-10(6-18-21(8)3)19-13-17-5-9(4-16-2)12(20-13)22-7-11(14)15/h4-6,11H,7H2,1-3H3,(H,17,19,20)/b16-4+ |
| InChIKey | QSVAENBDHNTZOC-AYSLTRBKSA-N |
| XLogP | 1.95 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|