C31H40N4O3 — CID 123704985
4-[4-[4-(4-butoxybutan-2-yl)phenyl]phenyl]-3-[[1-(cyclopropanecarbonyl)pyrrolidin-3-yl]methyl]-1H-1,2,4-triazol-5-one (PubChem CID 123704985) has the molecular formula C31H40N4O3 and a molecular weight of 516.69 g/mol. Its IUPAC name is 4-[4-[4-(4-butoxybutan-2-yl)phenyl]phenyl]-3-[[1-(cyclopropanecarbonyl)pyrrolidin-3-yl]methyl]-1H-1,2,4-triazol-5-one.
| Compound Name | 4-[4-[4-(4-butoxybutan-2-yl)phenyl]phenyl]-3-[[1-(cyclopropanecarbonyl)pyrrolidin-3-yl]methyl]-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 123704985 |
| Molecular Formula | C31H40N4O3 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | 4-[4-[4-(4-butoxybutan-2-yl)phenyl]phenyl]-3-[[1-(cyclopropanecarbonyl)pyrrolidin-3-yl]methyl]-1H-1,2,4-triazol-5-one |
| SMILES | CCCCOCCC(C)c1ccc(-c2ccc(-n3c(CC4CCN(C(=O)C5CC5)C4)n[nH]c3=O)cc2)cc1 |
| InChI | InChI=1S/C31H40N4O3/c1-3-4-18-38-19-16-22(2)24-5-7-25(8-6-24)26-11-13-28(14-12-26)35-29(32-33-31(35)37)20-23-15-17-34(21-23)30(36)27-9-10-27/h5-8,11-14,22-23,27H,3-4,9-10,15-21H2,1-2H3,(H,33,37) |
| InChIKey | LIYAEFISIFTQDR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 80.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|