About pent-2-enyl carbonochloridate
pent-2-enyl carbonochloridate (PubChem CID 123705465) has the molecular formula C6H9ClO2
and a molecular weight of 148.59 g/mol. Its IUPAC name is pent-2-enyl carbonochloridate.
Molecular Properties
| Compound Name | pent-2-enyl carbonochloridate |
| PubChem CID | 123705465 |
| Molecular Formula | C6H9ClO2 |
| Molecular Weight | 148.59 g/mol |
| Exact Mass | 148.03 |
| IUPAC Name | pent-2-enyl carbonochloridate |
| SMILES | CCC=CCOC(=O)Cl |
| InChI | InChI=1S/C6H9ClO2/c1-2-3-4-5-9-6(7)8/h3-4H,2,5H2,1H3 |
| InChIKey | LJBLBAAAFPFXNH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.59 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze pent-2-enyl carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-2-enyl carbonochloridate?
The IUPAC name of pent-2-enyl carbonochloridate (CID 123705465) is pent-2-enyl carbonochloridate.
What is the SMILES notation for pent-2-enyl carbonochloridate?
The canonical SMILES for pent-2-enyl carbonochloridate is CCC=CCOC(=O)Cl.
What is the InChIKey of pent-2-enyl carbonochloridate?
The InChIKey is LJBLBAAAFPFXNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClO2/c1-2-3-4-5-9-6(7)8/h3-4H,2,5H2,1H3.
What are the key properties of pent-2-enyl carbonochloridate?
pent-2-enyl carbonochloridate has a molecular weight of 148.59 g/mol, XLogP of 2.33, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pent-2-enyl carbonochloridate is sourced from PubChem (CID 123705465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).