C25H23F3O4 — CID 123705550
(1S,2R,6S,7R,8S)-8-[2-(trifluoromethoxy)phenyl]-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 123705550) has the molecular formula C25H23F3O4 and a molecular weight of 444.45 g/mol. Its IUPAC name is (1S,2R,6S,7R,8S)-8-[2-(trifluoromethoxy)phenyl]-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1S,2R,6S,7R,8S)-8-[2-(trifluoromethoxy)phenyl]-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 123705550 |
| Molecular Formula | C25H23F3O4 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | (1S,2R,6S,7R,8S)-8-[2-(trifluoromethoxy)phenyl]-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | Cc1cc(C)c(C2C(=O)[C@@H]3[C@@H]4O[C@@H](C[C@H]4c4ccccc4OC(F)(F)F)[C@@H]3C2=O)c(C)c1 |
| InChI | InChI=1S/C25H23F3O4/c1-11-8-12(2)18(13(3)9-11)20-22(29)19-17-10-15(24(31-17)21(19)23(20)30)14-6-4-5-7-16(14)32-25(26,27)28/h4-9,15,17,19-21,24H,10H2,1-3H3/t15-,17-,19-,20?,21+,24+/m0/s1 |
| InChIKey | OTCIDEOBOFWHJV-VBMWPZLPSA-N |
| XLogP | 4.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|