C19H20Cl2N8O — CID 123705599
7-azido-1H-pyrazolo[5,4-c]pyridine;2-chloro-1-[4-(4-chloro-3-methylphenyl)piperazin-1-yl]ethanone (PubChem CID 123705599) has the molecular formula C19H20Cl2N8O and a molecular weight of 447.33 g/mol. Its IUPAC name is 7-azido-1H-pyrazolo[5,4-c]pyridine;2-chloro-1-[4-(4-chloro-3-methylphenyl)piperazin-1-yl]ethanone.
| Compound Name | 7-azido-1H-pyrazolo[5,4-c]pyridine;2-chloro-1-[4-(4-chloro-3-methylphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 123705599 |
| Molecular Formula | C19H20Cl2N8O |
| Molecular Weight | 447.33 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 7-azido-1H-pyrazolo[5,4-c]pyridine;2-chloro-1-[4-(4-chloro-3-methylphenyl)piperazin-1-yl]ethanone |
| SMILES | Cc1cc(N2CCN(C(=O)CCl)CC2)ccc1Cl.[N-]=[N+]=Nc1nccc2cn[nH]c12 |
| InChI | InChI=1S/C13H16Cl2N2O.C6H4N6/c1-10-8-11(2-3-12(10)15)16-4-6-17(7-5-16)13(18)9-14;7-12-11-6-5-4(1-2-8-6)3-9-10-5/h2-3,8H,4-7,9H2,1H3;1-3H,(H,9,10) |
| InChIKey | XJHCJVOTRGAODL-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 113.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.33 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|