About 1-(C,N-dimethylcarbonimidoyl)-3-propan-2-ylurea
1-(C,N-dimethylcarbonimidoyl)-3-propan-2-ylurea (PubChem CID 123706100) has the molecular formula C7H15N3O
and a molecular weight of 157.22 g/mol. Its IUPAC name is 1-(C,N-dimethylcarbonimidoyl)-3-propan-2-ylurea.
Molecular Properties
| Compound Name | 1-(C,N-dimethylcarbonimidoyl)-3-propan-2-ylurea |
| PubChem CID | 123706100 |
| Molecular Formula | C7H15N3O |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.12 |
| IUPAC Name | 1-(C,N-dimethylcarbonimidoyl)-3-propan-2-ylurea |
| SMILES | C/N=C(\C)NC(=O)NC(C)C |
| InChI | InChI=1S/C7H15N3O/c1-5(2)9-7(11)10-6(3)8-4/h5H,1-4H3,(H2,8,9,10,11) |
| InChIKey | KXKITKXUTXRBMQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(C,N-dimethylcarbonimidoyl)-3-propan-2-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(C,N-dimethylcarbonimidoyl)-3-propan-2-ylurea?
The IUPAC name of 1-(C,N-dimethylcarbonimidoyl)-3-propan-2-ylurea (CID 123706100) is 1-(C,N-dimethylcarbonimidoyl)-3-propan-2-ylurea.
What is the SMILES notation for 1-(C,N-dimethylcarbonimidoyl)-3-propan-2-ylurea?
The canonical SMILES for 1-(C,N-dimethylcarbonimidoyl)-3-propan-2-ylurea is C/N=C(\C)NC(=O)NC(C)C.
What is the InChIKey of 1-(C,N-dimethylcarbonimidoyl)-3-propan-2-ylurea?
The InChIKey is KXKITKXUTXRBMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3O/c1-5(2)9-7(11)10-6(3)8-4/h5H,1-4H3,(H2,8,9,10,11).
What are the key properties of 1-(C,N-dimethylcarbonimidoyl)-3-propan-2-ylurea?
1-(C,N-dimethylcarbonimidoyl)-3-propan-2-ylurea has a molecular weight of 157.22 g/mol, XLogP of 0.74, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(C,N-dimethylcarbonimidoyl)-3-propan-2-ylurea is sourced from PubChem (CID 123706100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).