C23H41NS — CID 123706253
N-[2-[(3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)sulfanyl]ethyl]-3,7-dimethylocta-2,6-dien-1-amine (PubChem CID 123706253) has the molecular formula C23H41NS and a molecular weight of 363.66 g/mol. Its IUPAC name is N-[2-[(3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)sulfanyl]ethyl]-3,7-dimethylocta-2,6-dien-1-amine.
| Compound Name | N-[2-[(3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)sulfanyl]ethyl]-3,7-dimethylocta-2,6-dien-1-amine |
|---|---|
| PubChem CID | 123706253 |
| Molecular Formula | C23H41NS |
| Molecular Weight | 363.66 g/mol |
| Exact Mass | 363.30 |
| IUPAC Name | N-[2-[(3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)sulfanyl]ethyl]-3,7-dimethylocta-2,6-dien-1-amine |
| SMILES | CC(C)=CCCC(C)=CCNCCSC1C(C)CC2CC(C)CC1C2 |
| InChI | InChI=1S/C23H41NS/c1-17(2)7-6-8-18(3)9-10-24-11-12-25-23-20(5)15-21-13-19(4)14-22(23)16-21/h7,9,19-24H,6,8,10-16H2,1-5H3 |
| InChIKey | UFCZGQINGIUJJN-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.66 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|