C41H67F3N2O2 — CID 123706264
[[4-[(5-methylcyclooctyl)methyl]-3-(trifluoromethyl)cyclohex-3-en-1-yl]amino]-[4-methyl-3-[3-(oxan-4-ylmethyl)-4,5,5a,6,7,8,9,9a-octahydro-1H-2-benzazepin-9-yl]cyclohexyl]methanol (PubChem CID 123706264) has the molecular formula C41H67F3N2O2 and a molecular weight of 676.99 g/mol. Its IUPAC name is [[4-[(5-methylcyclooctyl)methyl]-3-(trifluoromethyl)cyclohex-3-en-1-yl]amino]-[4-methyl-3-[3-(oxan-4-ylmethyl)-4,5,5a,6,7,8,9,9a-octahydro-1H-2-benzazepin-9-yl]cyclohexyl]methanol.
| Compound Name | [[4-[(5-methylcyclooctyl)methyl]-3-(trifluoromethyl)cyclohex-3-en-1-yl]amino]-[4-methyl-3-[3-(oxan-4-ylmethyl)-4,5,5a,6,7,8,9,9a-octahydro-1H-2-benzazepin-9-yl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 123706264 |
| Molecular Formula | C41H67F3N2O2 |
| Molecular Weight | 676.99 g/mol |
| Exact Mass | 676.52 |
| IUPAC Name | [[4-[(5-methylcyclooctyl)methyl]-3-(trifluoromethyl)cyclohex-3-en-1-yl]amino]-[4-methyl-3-[3-(oxan-4-ylmethyl)-4,5,5a,6,7,8,9,9a-octahydro-1H-2-benzazepin-9-yl]cyclohexyl]methanol |
| SMILES | CC1CCCC(CC2=C(C(F)(F)F)CC(NC(O)C3CCC(C)C(C4CCCC5CCC(CC6CCOCC6)=NCC54)C3)CC2)CCC1 |
| InChI | InChI=1S/C41H67F3N2O2/c1-27-6-3-8-29(9-4-7-27)22-32-15-17-35(25-39(32)41(42,43)44)46-40(47)33-13-12-28(2)37(24-33)36-11-5-10-31-14-16-34(45-26-38(31)36)23-30-18-20-48-21-19-30/h27-31,33,35-38,40,46-47H,3-26H2,1-2H3 |
| InChIKey | QMASTAOUHCTRPV-UHFFFAOYSA-N |
| XLogP | 10.44 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.99 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|