About 5-(ethylaminomethyl)-3,6-difluorooct-6-en-1-ol
5-(ethylaminomethyl)-3,6-difluorooct-6-en-1-ol (PubChem CID 123706605) has the molecular formula C11H21F2NO
and a molecular weight of 221.29 g/mol. Its IUPAC name is 5-(ethylaminomethyl)-3,6-difluorooct-6-en-1-ol.
Molecular Properties
| Compound Name | 5-(ethylaminomethyl)-3,6-difluorooct-6-en-1-ol |
| PubChem CID | 123706605 |
| Molecular Formula | C11H21F2NO |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 5-(ethylaminomethyl)-3,6-difluorooct-6-en-1-ol |
| SMILES | CC=C(F)C(CNCC)CC(F)CCO |
| InChI | InChI=1S/C11H21F2NO/c1-3-11(13)9(8-14-4-2)7-10(12)5-6-15/h3,9-10,14-15H,4-8H2,1-2H3 |
| InChIKey | BUELYFLTYSNJFA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(ethylaminomethyl)-3,6-difluorooct-6-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(ethylaminomethyl)-3,6-difluorooct-6-en-1-ol?
The IUPAC name of 5-(ethylaminomethyl)-3,6-difluorooct-6-en-1-ol (CID 123706605) is 5-(ethylaminomethyl)-3,6-difluorooct-6-en-1-ol.
What is the SMILES notation for 5-(ethylaminomethyl)-3,6-difluorooct-6-en-1-ol?
The canonical SMILES for 5-(ethylaminomethyl)-3,6-difluorooct-6-en-1-ol is CC=C(F)C(CNCC)CC(F)CCO.
What is the InChIKey of 5-(ethylaminomethyl)-3,6-difluorooct-6-en-1-ol?
The InChIKey is BUELYFLTYSNJFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21F2NO/c1-3-11(13)9(8-14-4-2)7-10(12)5-6-15/h3,9-10,14-15H,4-8H2,1-2H3.
What are the key properties of 5-(ethylaminomethyl)-3,6-difluorooct-6-en-1-ol?
5-(ethylaminomethyl)-3,6-difluorooct-6-en-1-ol has a molecular weight of 221.29 g/mol, XLogP of 2.20, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(ethylaminomethyl)-3,6-difluorooct-6-en-1-ol is sourced from PubChem (CID 123706605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).