About (3-hydroxy-2-methoxypropyl) 1-(2-methylthieno[3,2-b]thiophen-5-yl)cyclopropane-1-carboxylate
(3-hydroxy-2-methoxypropyl) 1-(2-methylthieno[3,2-b]thiophen-5-yl)cyclopropane-1-carboxylate (PubChem CID 123706785) has the molecular formula C15H18O4S2
and a molecular weight of 326.44 g/mol. Its IUPAC name is (3-hydroxy-2-methoxypropyl) 1-(2-methylthieno[3,2-b]thiophen-5-yl)cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | (3-hydroxy-2-methoxypropyl) 1-(2-methylthieno[3,2-b]thiophen-5-yl)cyclopropane-1-carboxylate |
| PubChem CID | 123706785 |
| Molecular Formula | C15H18O4S2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | (3-hydroxy-2-methoxypropyl) 1-(2-methylthieno[3,2-b]thiophen-5-yl)cyclopropane-1-carboxylate |
| SMILES | COC(CO)COC(=O)C1(c2cc3sc(C)cc3s2)CC1 |
| InChI | InChI=1S/C15H18O4S2/c1-9-5-11-12(20-9)6-13(21-11)15(3-4-15)14(17)19-8-10(7-16)18-2/h5-6,10,16H,3-4,7-8H2,1-2H3 |
| InChIKey | DKQJQFRAANDSKL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3-hydroxy-2-methoxypropyl) 1-(2-methylthieno[3,2-b]thiophen-5-yl)cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-2-methoxypropyl) 1-(2-methylthieno[3,2-b]thiophen-5-yl)cyclopropane-1-carboxylate?
The IUPAC name of (3-hydroxy-2-methoxypropyl) 1-(2-methylthieno[3,2-b]thiophen-5-yl)cyclopropane-1-carboxylate (CID 123706785) is (3-hydroxy-2-methoxypropyl) 1-(2-methylthieno[3,2-b]thiophen-5-yl)cyclopropane-1-carboxylate.
What is the SMILES notation for (3-hydroxy-2-methoxypropyl) 1-(2-methylthieno[3,2-b]thiophen-5-yl)cyclopropane-1-carboxylate?
The canonical SMILES for (3-hydroxy-2-methoxypropyl) 1-(2-methylthieno[3,2-b]thiophen-5-yl)cyclopropane-1-carboxylate is COC(CO)COC(=O)C1(c2cc3sc(C)cc3s2)CC1.
What is the InChIKey of (3-hydroxy-2-methoxypropyl) 1-(2-methylthieno[3,2-b]thiophen-5-yl)cyclopropane-1-carboxylate?
The InChIKey is DKQJQFRAANDSKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O4S2/c1-9-5-11-12(20-9)6-13(21-11)15(3-4-15)14(17)19-8-10(7-16)18-2/h5-6,10,16H,3-4,7-8H2,1-2H3.
What are the key properties of (3-hydroxy-2-methoxypropyl) 1-(2-methylthieno[3,2-b]thiophen-5-yl)cyclopropane-1-carboxylate?
(3-hydroxy-2-methoxypropyl) 1-(2-methylthieno[3,2-b]thiophen-5-yl)cyclopropane-1-carboxylate has a molecular weight of 326.44 g/mol, XLogP of 2.85, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-2-methoxypropyl) 1-(2-methylthieno[3,2-b]thiophen-5-yl)cyclopropane-1-carboxylate is sourced from PubChem (CID 123706785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).