C40H46F6N6O4 — CID 123706966
6,6,6-trifluoro-N-(oxan-4-yl)-3-[5-[4-[4-[2-[6,6,6-trifluoro-1-(oxan-4-ylamino)-1-oxohexan-3-yl]-1H-imidazol-5-yl]phenyl]phenyl]-1H-imidazol-2-yl]hexanamide (PubChem CID 123706966) has the molecular formula C40H46F6N6O4 and a molecular weight of 788.83 g/mol. Its IUPAC name is 6,6,6-trifluoro-N-(oxan-4-yl)-3-[5-[4-[4-[2-[6,6,6-trifluoro-1-(oxan-4-ylamino)-1-oxohexan-3-yl]-1H-imidazol-5-yl]phenyl]phenyl]-1H-imidazol-2-yl]hexanamide.
| Compound Name | 6,6,6-trifluoro-N-(oxan-4-yl)-3-[5-[4-[4-[2-[6,6,6-trifluoro-1-(oxan-4-ylamino)-1-oxohexan-3-yl]-1H-imidazol-5-yl]phenyl]phenyl]-1H-imidazol-2-yl]hexanamide |
|---|---|
| PubChem CID | 123706966 |
| Molecular Formula | C40H46F6N6O4 |
| Molecular Weight | 788.83 g/mol |
| Exact Mass | 788.35 |
| IUPAC Name | 6,6,6-trifluoro-N-(oxan-4-yl)-3-[5-[4-[4-[2-[6,6,6-trifluoro-1-(oxan-4-ylamino)-1-oxohexan-3-yl]-1H-imidazol-5-yl]phenyl]phenyl]-1H-imidazol-2-yl]hexanamide |
| SMILES | O=C(CC(CCC(F)(F)F)c1ncc(-c2ccc(-c3ccc(-c4cnc(C(CCC(F)(F)F)CC(=O)NC5CCOCC5)[nH]4)cc3)cc2)[nH]1)NC1CCOCC1 |
| InChI | InChI=1S/C40H46F6N6O4/c41-39(42,43)15-9-29(21-35(53)49-31-11-17-55-18-12-31)37-47-23-33(51-37)27-5-1-25(2-6-27)26-3-7-28(8-4-26)34-24-48-38(52-34)30(10-16-40(44,45)46)22-36(54)50-32-13-19-56-20-14-32/h1-8,23-24,29-32H,9-22H2,(H,47,51)(H,48,52)(H,49,53)(H,50,54) |
| InChIKey | UFEKOURWSMEGOT-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.83 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |