C10H15N5S2 — CID 123706975
5-[4-(5-ethyl-1,3,4-thiadiazol-2-yl)butyl]-1,3,4-thiadiazol-2-amine (PubChem CID 123706975) has the molecular formula C10H15N5S2 and a molecular weight of 269.40 g/mol. Its IUPAC name is 5-[4-(5-ethyl-1,3,4-thiadiazol-2-yl)butyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[4-(5-ethyl-1,3,4-thiadiazol-2-yl)butyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 123706975 |
| Molecular Formula | C10H15N5S2 |
| Molecular Weight | 269.40 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 5-[4-(5-ethyl-1,3,4-thiadiazol-2-yl)butyl]-1,3,4-thiadiazol-2-amine |
| SMILES | CCc1nnc(CCCCc2nnc(N)s2)s1 |
| InChI | InChI=1S/C10H15N5S2/c1-2-7-12-13-8(16-7)5-3-4-6-9-14-15-10(11)17-9/h2-6H2,1H3,(H2,11,15) |
| InChIKey | RXZDWJHHMQZTET-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|