C26H33N5O6S — CID 123707308
2-[3,9-bis(carboxymethyl)-4-[[4-(ethanethioylamino)phenyl]methyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-6-yl]acetic acid (PubChem CID 123707308) has the molecular formula C26H33N5O6S and a molecular weight of 543.65 g/mol. Its IUPAC name is 2-[3,9-bis(carboxymethyl)-4-[[4-(ethanethioylamino)phenyl]methyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-6-yl]acetic acid.
| Compound Name | 2-[3,9-bis(carboxymethyl)-4-[[4-(ethanethioylamino)phenyl]methyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-6-yl]acetic acid |
|---|---|
| PubChem CID | 123707308 |
| Molecular Formula | C26H33N5O6S |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | 2-[3,9-bis(carboxymethyl)-4-[[4-(ethanethioylamino)phenyl]methyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-6-yl]acetic acid |
| SMILES | CC(=S)Nc1ccc(CC2CN(CC(=O)O)CCN(CC(=O)O)Cc3cccc(n3)CN2CC(=O)O)cc1 |
| InChI | InChI=1S/C26H33N5O6S/c1-18(38)27-20-7-5-19(6-8-20)11-23-14-30(16-25(34)35)10-9-29(15-24(32)33)12-21-3-2-4-22(28-21)13-31(23)17-26(36)37/h2-8,23H,9-17H2,1H3,(H,27,38)(H,32,33)(H,34,35)(H,36,37) |
| InChIKey | GNJDSMOFJVRHHV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 146.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|