C22H24FN5O4 — CID 123707375
(2,5-dihydroxypyrrol-1-yl) 2-[[3-(3-fluorophenyl)-1-methylpyrazol-5-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 123707375) has the molecular formula C22H24FN5O4 and a molecular weight of 441.46 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-[[3-(3-fluorophenyl)-1-methylpyrazol-5-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-[[3-(3-fluorophenyl)-1-methylpyrazol-5-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 123707375 |
| Molecular Formula | C22H24FN5O4 |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-[[3-(3-fluorophenyl)-1-methylpyrazol-5-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | Cn1nc(-c2cccc(F)c2)cc1CN1CC2CN(C(=O)On3c(O)ccc3O)CC2C1 |
| InChI | InChI=1S/C22H24FN5O4/c1-25-18(8-19(24-25)14-3-2-4-17(23)7-14)13-26-9-15-11-27(12-16(15)10-26)22(31)32-28-20(29)5-6-21(28)30/h2-8,15-16,29-30H,9-13H2,1H3 |
| InChIKey | GGHFOOYLQYGPHO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |