C25H31F6IO2 — CID 123707380
2-(3,3-difluoro-2-iodoprop-1-enoxy)-5-[difluoro-[4-(4-propylcyclohexyl)cyclohexyl]methoxy]-1,3-difluorobenzene (PubChem CID 123707380) has the molecular formula C25H31F6IO2 and a molecular weight of 604.41 g/mol. Its IUPAC name is 2-(3,3-difluoro-2-iodoprop-1-enoxy)-5-[difluoro-[4-(4-propylcyclohexyl)cyclohexyl]methoxy]-1,3-difluorobenzene.
| Compound Name | 2-(3,3-difluoro-2-iodoprop-1-enoxy)-5-[difluoro-[4-(4-propylcyclohexyl)cyclohexyl]methoxy]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 123707380 |
| Molecular Formula | C25H31F6IO2 |
| Molecular Weight | 604.41 g/mol |
| Exact Mass | 604.13 |
| IUPAC Name | 2-(3,3-difluoro-2-iodoprop-1-enoxy)-5-[difluoro-[4-(4-propylcyclohexyl)cyclohexyl]methoxy]-1,3-difluorobenzene |
| SMILES | CCCC1CCC(C2CCC(C(F)(F)Oc3cc(F)c(OC=C(I)C(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C25H31F6IO2/c1-2-3-15-4-6-16(7-5-15)17-8-10-18(11-9-17)25(30,31)34-19-12-20(26)23(21(27)13-19)33-14-22(32)24(28)29/h12-18,24H,2-11H2,1H3 |
| InChIKey | ZQCXEGAVEACPIP-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.41 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|