C17H17F7N2OS — CID 123707522
2-(difluoromethyl)-5-[[2,4-dimethyl-5-(2,2,3,3,3-pentafluoropropylsulfinyl)phenyl]methyl]-1,4-dihydropyrimidine (PubChem CID 123707522) has the molecular formula C17H17F7N2OS and a molecular weight of 430.39 g/mol. Its IUPAC name is 2-(difluoromethyl)-5-[[2,4-dimethyl-5-(2,2,3,3,3-pentafluoropropylsulfinyl)phenyl]methyl]-1,4-dihydropyrimidine.
| Compound Name | 2-(difluoromethyl)-5-[[2,4-dimethyl-5-(2,2,3,3,3-pentafluoropropylsulfinyl)phenyl]methyl]-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 123707522 |
| Molecular Formula | C17H17F7N2OS |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 2-(difluoromethyl)-5-[[2,4-dimethyl-5-(2,2,3,3,3-pentafluoropropylsulfinyl)phenyl]methyl]-1,4-dihydropyrimidine |
| SMILES | Cc1cc(C)c(S(=O)CC(F)(F)C(F)(F)F)cc1CC1=CNC(C(F)F)=NC1 |
| InChI | InChI=1S/C17H17F7N2OS/c1-9-3-10(2)13(28(27)8-16(20,21)17(22,23)24)5-12(9)4-11-6-25-15(14(18)19)26-7-11/h3,5-6,14H,4,7-8H2,1-2H3,(H,25,26) |
| InChIKey | ZGSURJIRDOOYCT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|