C16H29N7O — CID 123707932
2-[3-[5-(6-methyl-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)pentylamino]propyl]guanidine (PubChem CID 123707932) has the molecular formula C16H29N7O and a molecular weight of 335.46 g/mol. Its IUPAC name is 2-[3-[5-(6-methyl-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)pentylamino]propyl]guanidine.
| Compound Name | 2-[3-[5-(6-methyl-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)pentylamino]propyl]guanidine |
|---|---|
| PubChem CID | 123707932 |
| Molecular Formula | C16H29N7O |
| Molecular Weight | 335.46 g/mol |
| Exact Mass | 335.24 |
| IUPAC Name | 2-[3-[5-(6-methyl-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)pentylamino]propyl]guanidine |
| SMILES | CC1=CC2=CN(CCCCCNCCCN=C(N)N)C(=O)NC2N1 |
| InChI | InChI=1S/C16H29N7O/c1-12-10-13-11-23(16(24)22-14(13)21-12)9-4-2-3-6-19-7-5-8-20-15(17)18/h10-11,14,19,21H,2-9H2,1H3,(H,22,24)(H4,17,18,20) |
| InChIKey | DLOUIKZAGDNWSF-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.46 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|