C15H14F2N4S — CID 123708094
6-(3,4-difluorophenyl)-4,6-dimethyl-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidin-5-imine (PubChem CID 123708094) has the molecular formula C15H14F2N4S and a molecular weight of 320.37 g/mol. Its IUPAC name is 6-(3,4-difluorophenyl)-4,6-dimethyl-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidin-5-imine.
| Compound Name | 6-(3,4-difluorophenyl)-4,6-dimethyl-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidin-5-imine |
|---|---|
| PubChem CID | 123708094 |
| Molecular Formula | C15H14F2N4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 6-(3,4-difluorophenyl)-4,6-dimethyl-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidin-5-imine |
| SMILES | [H]/N=C1\C(C)N=C(c2nccs2)NC1(C)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H14F2N4S/c1-8-12(18)15(2,9-3-4-10(16)11(17)7-9)21-13(20-8)14-19-5-6-22-14/h3-8,18H,1-2H3,(H,20,21)/b18-12+ |
| InChIKey | ZVSOQNHTMAXQFX-LDADJPATSA-N |
| XLogP | 3.09 |
| TPSA | 61.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|