C15H20O9 — CID 123708899
methyl 3,4-diacetyloxy-2-(2-acetyloxyethyl)-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 123708899) has the molecular formula C15H20O9 and a molecular weight of 344.32 g/mol. Its IUPAC name is methyl 3,4-diacetyloxy-2-(2-acetyloxyethyl)-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl 3,4-diacetyloxy-2-(2-acetyloxyethyl)-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 123708899 |
| Molecular Formula | C15H20O9 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | methyl 3,4-diacetyloxy-2-(2-acetyloxyethyl)-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | COC(=O)C1=CC(OC(C)=O)C(OC(C)=O)C(CCOC(C)=O)O1 |
| InChI | InChI=1S/C15H20O9/c1-8(16)21-6-5-11-14(23-10(3)18)12(22-9(2)17)7-13(24-11)15(19)20-4/h7,11-12,14H,5-6H2,1-4H3 |
| InChIKey | FIQBNYXHTPGGHH-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|